C23H27NO — CID 10065431
(1R,9R,10R)-4-methoxy-17-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 10065431) has the molecular formula C23H27NO and a molecular weight of 333.47 g/mol. Its IUPAC name is (1R,9R,10R)-4-methoxy-17-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10R)-4-methoxy-17-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10065431 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (1R,9R,10R)-4-methoxy-17-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(c1ccccc1)CC3 |
| InChI | InChI=1S/C23H27NO/c1-25-19-11-10-17-15-22-20-9-5-6-12-23(20,21(17)16-19)13-14-24(22)18-7-3-2-4-8-18/h2-4,7-8,10-11,16,20,22H,5-6,9,12-15H2,1H3/t20-,22+,23+/m0/s1 |
| InChIKey | OBJTXERBWHPAQB-MDNUFGMLSA-N |
| XLogP | 4.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |