C26H28N2O2 — CID 15974229
1H-indol-5-yl-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methanone (PubChem CID 15974229) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1H-indol-5-yl-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methanone.
| Compound Name | 1H-indol-5-yl-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methanone |
|---|---|
| PubChem CID | 15974229 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1H-indol-5-yl-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methanone |
| SMILES | COc1ccc2c(c1)[C@]13CCCC[C@H]1[C@H](C2)N(C(=O)c1ccc2[nH]ccc2c1)CC3 |
| InChI | InChI=1S/C26H28N2O2/c1-30-20-7-5-17-15-24-21-4-2-3-10-26(21,22(17)16-20)11-13-28(24)25(29)19-6-8-23-18(14-19)9-12-27-23/h5-9,12,14,16,21,24,27H,2-4,10-11,13,15H2,1H3/t21-,24-,26-/m0/s1 |
| InChIKey | JDGQRMJNWSZPFC-CVJWPJSTSA-N |
| XLogP | 5.08 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |