C26H30N2O — CID 10475271
(1R,9R,10R)-17-(1H-indol-5-ylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 10475271) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (1R,9R,10R)-17-(1H-indol-5-ylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10R)-17-(1H-indol-5-ylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10475271 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (1R,9R,10R)-17-(1H-indol-5-ylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(Cc1ccc2[nH]ccc2c1)CC3 |
| InChI | InChI=1S/C26H30N2O/c1-29-21-7-6-19-15-25-22-4-2-3-10-26(22,23(19)16-21)11-13-28(25)17-18-5-8-24-20(14-18)9-12-27-24/h5-9,12,14,16,22,25,27H,2-4,10-11,13,15,17H2,1H3/t22-,25+,26+/m0/s1 |
| InChIKey | PSHQAWLHFNSWFA-HDYLNDSGSA-N |
| XLogP | 5.44 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |