C16H21NO3 — CID 25178335
methyl (4aS,10aR)-8-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-1-carboxylate (PubChem CID 25178335) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl (4aS,10aR)-8-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-1-carboxylate.
| Compound Name | methyl (4aS,10aR)-8-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 25178335 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl (4aS,10aR)-8-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@H]2Cc3ccc(OC)cc3C[C@H]21 |
| InChI | InChI=1S/C16H21NO3/c1-19-14-6-5-11-8-12-4-3-7-17(16(18)20-2)15(12)10-13(11)9-14/h5-6,9,12,15H,3-4,7-8,10H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | PRKMXAXNNVZVSP-SWLSCSKDSA-N |
| XLogP | 2.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |