C24H28N2O3 — CID 22166646
phenyl 3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxylate (PubChem CID 22166646) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is phenyl 3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxylate.
| Compound Name | phenyl 3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxylate |
|---|---|
| PubChem CID | 22166646 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | phenyl 3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxylate |
| SMILES | COc1ccc2c(c1)CCN1CC3CCCN(C(=O)Oc4ccccc4)C3CC21 |
| InChI | InChI=1S/C24H28N2O3/c1-28-20-9-10-21-17(14-20)11-13-25-16-18-6-5-12-26(22(18)15-23(21)25)24(27)29-19-7-3-2-4-8-19/h2-4,7-10,14,18,22-23H,5-6,11-13,15-16H2,1H3 |
| InChIKey | NLJAOYZFTNNZCT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |