C31H43N3O2 — CID 18636304
(8aR,12aS,13aR)-3-hexoxy-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide (PubChem CID 18636304) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is (8aR,12aS,13aR)-3-hexoxy-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide.
| Compound Name | (8aR,12aS,13aR)-3-hexoxy-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
|---|---|
| PubChem CID | 18636304 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | (8aR,12aS,13aR)-3-hexoxy-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
| SMILES | CCCCCCOc1ccc2c(c1)CCN1C[C@H]3CCCN(C(=O)NCCc4ccccc4)[C@H]3C[C@H]21 |
| InChI | InChI=1S/C31H43N3O2/c1-2-3-4-8-20-36-27-13-14-28-25(21-27)16-19-33-23-26-12-9-18-34(29(26)22-30(28)33)31(35)32-17-15-24-10-6-5-7-11-24/h5-7,10-11,13-14,21,26,29-30H,2-4,8-9,12,15-20,22-23H2,1H3,(H,32,35)/t26-,29+,30-/m1/s1 |
| InChIKey | BNJKWBOYEUMGAK-JJZPZGAKSA-N |
| XLogP | 5.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|