C22H34N2O — CID 56979048
(8aS,12aR,13aR)-3-hexoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 56979048) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (8aS,12aR,13aR)-3-hexoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aS,12aR,13aR)-3-hexoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 56979048 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (8aS,12aR,13aR)-3-hexoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCCCCCOc1ccc2c(c1)CCN1C[C@@H]3CCCN[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C22H34N2O/c1-2-3-4-5-13-25-19-8-9-20-17(14-19)10-12-24-16-18-7-6-11-23-21(18)15-22(20)24/h8-9,14,18,21-23H,2-7,10-13,15-16H2,1H3/t18-,21+,22+/m0/s1 |
| InChIKey | QLOKUUDOGVYROP-VLCRHTCISA-N |
| XLogP | 4.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|