C22H34N2 — CID 57179195
(8aS,12aR,13aR)-3-hexyl-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 57179195) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (8aS,12aR,13aR)-3-hexyl-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aS,12aR,13aR)-3-hexyl-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 57179195 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | (8aS,12aR,13aR)-3-hexyl-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCCCCCc1ccc2c(c1)CCN1C[C@@H]3CCCN[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C22H34N2/c1-2-3-4-5-7-17-9-10-20-18(14-17)11-13-24-16-19-8-6-12-23-21(19)15-22(20)24/h9-10,14,19,21-23H,2-8,11-13,15-16H2,1H3/t19-,21+,22+/m0/s1 |
| InChIKey | SZXOVOPJZPBLGM-KSEOMHKRSA-N |
| XLogP | 4.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|