C25H41N3O2S — CID 67881599
3-[[(8aR,12aS,13aS)-3-hexyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine (PubChem CID 67881599) has the molecular formula C25H41N3O2S and a molecular weight of 447.69 g/mol. Its IUPAC name is 3-[[(8aR,12aS,13aS)-3-hexyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine.
| Compound Name | 3-[[(8aR,12aS,13aS)-3-hexyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine |
|---|---|
| PubChem CID | 67881599 |
| Molecular Formula | C25H41N3O2S |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 3-[[(8aR,12aS,13aS)-3-hexyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine |
| SMILES | CCCCCCc1ccc2c(c1)CCN1C[C@H]3CCCN(S(=O)(=O)CCCN)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C25H41N3O2S/c1-2-3-4-5-8-20-10-11-23-21(17-20)12-15-27-19-22-9-6-14-28(24(22)18-25(23)27)31(29,30)16-7-13-26/h10-11,17,22,24-25H,2-9,12-16,18-19,26H2,1H3/t22-,24+,25+/m1/s1 |
| InChIKey | JGELBHPNQCIVGI-VJTSUQJLSA-N |
| XLogP | 3.87 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|