C27H46N4O5S2 — CID 67881595
(8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-hexoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67881595) has the molecular formula C27H46N4O5S2 and a molecular weight of 570.82 g/mol. Its IUPAC name is (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-hexoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-hexoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67881595 |
| Molecular Formula | C27H46N4O5S2 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-hexoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCCCCCOc1ccc2c(c1)CCN1C[C@@H]3CCCN(S(=O)(=O)CCCNS(=O)(=O)N(C)C)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C27H46N4O5S2/c1-4-5-6-7-17-36-24-11-12-25-22(19-24)13-16-30-21-23-10-8-15-31(26(23)20-27(25)30)37(32,33)18-9-14-28-38(34,35)29(2)3/h11-12,19,23,26-28H,4-10,13-18,20-21H2,1-3H3/t23-,26+,27-/m0/s1 |
| InChIKey | JICKOIAKNDJFOV-RNJDCESWSA-N |
| XLogP | 3.15 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|