C22H34N4O6S2 — CID 67881517
(1S,15R,20S)-19-[3-(dimethylsulfamoylamino)propylsulfonyl]-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene (PubChem CID 67881517) has the molecular formula C22H34N4O6S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is (1S,15R,20S)-19-[3-(dimethylsulfamoylamino)propylsulfonyl]-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene.
| Compound Name | (1S,15R,20S)-19-[3-(dimethylsulfamoylamino)propylsulfonyl]-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene |
|---|---|
| PubChem CID | 67881517 |
| Molecular Formula | C22H34N4O6S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | (1S,15R,20S)-19-[3-(dimethylsulfamoylamino)propylsulfonyl]-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene |
| SMILES | CN(C)S(=O)(=O)NCCCS(=O)(=O)N1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5 |
| InChI | InChI=1S/C22H34N4O6S2/c1-24(2)34(29,30)23-7-4-10-33(27,28)26-8-3-5-17-14-25-9-6-16-11-21-22(32-15-31-21)12-18(16)20(25)13-19(17)26/h11-12,17,19-20,23H,3-10,13-15H2,1-2H3/t17-,19+,20+/m1/s1 |
| InChIKey | UFGUKYKAMMACHV-HOJAQTOUSA-N |
| XLogP | 0.91 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|