C21H34N4O5S2 — CID 67881507
(8aR,12aS,13aS)-3-ethoxy-12-[3-(sulfamoylamino)propylsulfonyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67881507) has the molecular formula C21H34N4O5S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is (8aR,12aS,13aS)-3-ethoxy-12-[3-(sulfamoylamino)propylsulfonyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aR,12aS,13aS)-3-ethoxy-12-[3-(sulfamoylamino)propylsulfonyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67881507 |
| Molecular Formula | C21H34N4O5S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (8aR,12aS,13aS)-3-ethoxy-12-[3-(sulfamoylamino)propylsulfonyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCOc1ccc2c(c1)CCN1C[C@H]3CCCN(S(=O)(=O)CCCNS(N)(=O)=O)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C21H34N4O5S2/c1-2-30-18-6-7-19-16(13-18)8-11-24-15-17-5-3-10-25(20(17)14-21(19)24)31(26,27)12-4-9-23-32(22,28)29/h6-7,13,17,20-21,23H,2-5,8-12,14-15H2,1H3,(H2,22,28,29)/t17-,20+,21+/m1/s1 |
| InChIKey | DSGMZJYDTVMHTM-QMMLZNLJSA-N |
| XLogP | 0.98 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|