C24H40N4O5S2 — CID 67881723
(8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-propan-2-yloxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67881723) has the molecular formula C24H40N4O5S2 and a molecular weight of 528.74 g/mol. Its IUPAC name is (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-propan-2-yloxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-propan-2-yloxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67881723 |
| Molecular Formula | C24H40N4O5S2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3-propan-2-yloxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CC(C)Oc1ccc2c(c1)CCN1C[C@@H]3CCCN(S(=O)(=O)CCCNS(=O)(=O)N(C)C)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C24H40N4O5S2/c1-18(2)33-21-8-9-22-19(15-21)10-13-27-17-20-7-5-12-28(23(20)16-24(22)27)34(29,30)14-6-11-25-35(31,32)26(3)4/h8-9,15,18,20,23-25H,5-7,10-14,16-17H2,1-4H3/t20-,23+,24-/m0/s1 |
| InChIKey | OIUQJUBGZHECPB-ZTCOLXNVSA-N |
| XLogP | 1.97 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|