C25H42N4O6S2 — CID 67881528
(8aR,12aS,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-2,3-diethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67881528) has the molecular formula C25H42N4O6S2 and a molecular weight of 558.77 g/mol. Its IUPAC name is (8aR,12aS,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-2,3-diethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aR,12aS,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-2,3-diethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67881528 |
| Molecular Formula | C25H42N4O6S2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (8aR,12aS,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-2,3-diethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCOc1cc2c(cc1OCC)[C@@H]1C[C@H]3[C@H](CCCN3S(=O)(=O)CCCNS(=O)(=O)N(C)C)CN1CC2 |
| InChI | InChI=1S/C25H42N4O6S2/c1-5-34-24-15-19-10-13-28-18-20-9-7-12-29(22(20)17-23(28)21(19)16-25(24)35-6-2)36(30,31)14-8-11-26-37(32,33)27(3)4/h15-16,20,22-23,26H,5-14,17-18H2,1-4H3/t20-,22+,23+/m1/s1 |
| InChIKey | BLIFTMQEQFKQJD-PUHATCMVSA-N |
| XLogP | 1.98 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|