C27H45N3O4S — CID 67881753
3-[[(8aR,12aS,13aS)-2,3-dibutoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine (PubChem CID 67881753) has the molecular formula C27H45N3O4S and a molecular weight of 507.74 g/mol. Its IUPAC name is 3-[[(8aR,12aS,13aS)-2,3-dibutoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine.
| Compound Name | 3-[[(8aR,12aS,13aS)-2,3-dibutoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine |
|---|---|
| PubChem CID | 67881753 |
| Molecular Formula | C27H45N3O4S |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | 3-[[(8aR,12aS,13aS)-2,3-dibutoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine |
| SMILES | CCCCOc1cc2c(cc1OCCCC)[C@@H]1C[C@H]3[C@H](CCCN3S(=O)(=O)CCCN)CN1CC2 |
| InChI | InChI=1S/C27H45N3O4S/c1-3-5-14-33-26-17-21-10-13-29-20-22-9-7-12-30(35(31,32)16-8-11-28)24(22)19-25(29)23(21)18-27(26)34-15-6-4-2/h17-18,22,24-25H,3-16,19-20,28H2,1-2H3/t22-,24+,25+/m1/s1 |
| InChIKey | HIWCDIWWCWVMJC-VJTSUQJLSA-N |
| XLogP | 4.11 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|