C21H33N3O4S — CID 67881742
3-[[(8aS,12aR,13aS)-1,2-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine (PubChem CID 67881742) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-[[(8aS,12aR,13aS)-1,2-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine.
| Compound Name | 3-[[(8aS,12aR,13aS)-1,2-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine |
|---|---|
| PubChem CID | 67881742 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-[[(8aS,12aR,13aS)-1,2-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propan-1-amine |
| SMILES | COc1ccc2c(c1OC)[C@@H]1C[C@@H]3[C@@H](CCCN3S(=O)(=O)CCCN)CN1CC2 |
| InChI | InChI=1S/C21H33N3O4S/c1-27-19-7-6-15-8-11-23-14-16-5-3-10-24(29(25,26)12-4-9-22)17(16)13-18(23)20(15)21(19)28-2/h6-7,16-18H,3-5,8-14,22H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | LLCRUJASTBASQU-KSZLIROESA-N |
| XLogP | 1.77 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |