C19H29ClN2O4S — CID 67870302
(8aR,12aS,13aS)-1,4-dimethoxy-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride (PubChem CID 67870302) has the molecular formula C19H29ClN2O4S and a molecular weight of 416.97 g/mol. Its IUPAC name is (8aR,12aS,13aS)-1,4-dimethoxy-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride.
| Compound Name | (8aR,12aS,13aS)-1,4-dimethoxy-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 67870302 |
| Molecular Formula | C19H29ClN2O4S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (8aR,12aS,13aS)-1,4-dimethoxy-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
| SMILES | COc1ccc(OC)c2c1CCN1C[C@H]3CCCN(S(C)(=O)=O)[C@H]3C[C@@H]21.Cl |
| InChI | InChI=1S/C19H28N2O4S.ClH/c1-24-17-6-7-18(25-2)19-14(17)8-10-20-12-13-5-4-9-21(26(3,22)23)15(13)11-16(19)20;/h6-7,13,15-16H,4-5,8-12H2,1-3H3;1H/t13-,15+,16+;/m1./s1 |
| InChIKey | OADBDEIDPNVWAD-KHUAAREISA-N |
| XLogP | 2.47 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |