C36H50N4O12S3 — CID 173361555
bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene);sulfuric acid (PubChem CID 173361555) has the molecular formula C36H50N4O12S3 and a molecular weight of 827.01 g/mol. Its IUPAC name is bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene);sulfuric acid.
| Compound Name | bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene);sulfuric acid |
|---|---|
| PubChem CID | 173361555 |
| Molecular Formula | C36H50N4O12S3 |
| Molecular Weight | 827.01 g/mol |
| Exact Mass | 826.26 |
| IUPAC Name | bis((1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene);sulfuric acid |
| SMILES | CS(=O)(=O)N1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5.CS(=O)(=O)N1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5.O=S(=O)(O)O |
| InChI | InChI=1S/2C18H24N2O4S.H2O4S/c2*1-25(21,22)20-5-2-3-13-10-19-6-4-12-7-17-18(24-11-23-17)8-14(12)16(19)9-15(13)20;1-5(2,3)4/h2*7-8,13,15-16H,2-6,9-11H2,1H3;(H2,1,2,3,4)/t2*13-,15+,16+;/m11./s1 |
| InChIKey | JFXQDMBFFKGYDA-CCRAPGDGSA-N |
| XLogP | 2.86 |
| TPSA | 192.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.01 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|