C23H32N4O3 — CID 22164213
5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl-(4-methylpiperazin-1-yl)methanone (PubChem CID 22164213) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl-(4-methylpiperazin-1-yl)methanone.
| Compound Name | 5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 22164213 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)N2CCCC3CN4CCc5cc6c(cc5C4CC32)OCO6)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-24-7-9-25(10-8-24)23(28)27-5-2-3-17-14-26-6-4-16-11-21-22(30-15-29-21)12-18(16)20(26)13-19(17)27/h11-12,17,19-20H,2-10,13-15H2,1H3 |
| InChIKey | SMDVJHAMGPDIOW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |