C20H23NO5 — CID 11089613
methyl (1S,15S,19S,20S)-18-oxo-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate (PubChem CID 11089613) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl (1S,15S,19S,20S)-18-oxo-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate.
| Compound Name | methyl (1S,15S,19S,20S)-18-oxo-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate |
|---|---|
| PubChem CID | 11089613 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methyl (1S,15S,19S,20S)-18-oxo-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)CC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5 |
| InChI | InChI=1S/C20H23NO5/c1-24-20(23)19-14-7-15-13-8-18-17(25-10-26-18)6-11(13)4-5-21(15)9-12(14)2-3-16(19)22/h6,8,12,14-15,19H,2-5,7,9-10H2,1H3/t12-,14+,15+,19+/m1/s1 |
| InChIKey | XFQKRDXWXQKAMB-MOMAJJCNSA-N |
| XLogP | 2.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|