C21H23N3O4 — CID 10068534
methyl 2-(azanylidyne(114C)methyl)-2-[(2S,3S,12bS)-3-(2-cyanoethyl)-2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-yl]acetate (PubChem CID 10068534) has the molecular formula C21H23N3O4 and a molecular weight of 383.42 g/mol. Its IUPAC name is methyl 2-(azanylidyne(114C)methyl)-2-[(2S,3S,12bS)-3-(2-cyanoethyl)-2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-yl]acetate.
| Compound Name | methyl 2-(azanylidyne(114C)methyl)-2-[(2S,3S,12bS)-3-(2-cyanoethyl)-2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-yl]acetate |
|---|---|
| PubChem CID | 10068534 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | methyl 2-(azanylidyne(114C)methyl)-2-[(2S,3S,12bS)-3-(2-cyanoethyl)-2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-yl]acetate |
| SMILES | COC(=O)C([14C]#N)[C@H]1C[C@H]2c3cc4c(cc3CCN2C[C@H]1CCC#N)OCO4 |
| InChI | InChI=1S/C21H23N3O4/c1-26-21(25)17(10-23)15-8-18-16-9-20-19(27-12-28-20)7-13(16)4-6-24(18)11-14(15)3-2-5-22/h7,9,14-15,17-18H,2-4,6,8,11-12H2,1H3/t14-,15+,17?,18+/m1/s1/i10+2 |
| InChIKey | OIDJOYPDIKWSOW-DHCDHLMASA-N |
| XLogP | 2.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |