C14H18N2O2 — CID 20559728
2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-amine (PubChem CID 20559728) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-amine.
| Compound Name | 2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-amine |
|---|---|
| PubChem CID | 20559728 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2,3,4,6,7,12b-hexahydro-1H-[1,3]benzodioxolo[6,5-a]quinolizin-2-amine |
| SMILES | NC1CCN2CCc3cc4c(cc3C2C1)OCO4 |
| InChI | InChI=1S/C14H18N2O2/c15-10-2-4-16-3-1-9-5-13-14(18-8-17-13)7-11(9)12(16)6-10/h5,7,10,12H,1-4,6,8,15H2 |
| InChIKey | PIDSUWSMSZDKBW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |