C13H18N2 — CID 12940176
(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine (PubChem CID 12940176) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine.
| Compound Name | (2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
|---|---|
| PubChem CID | 12940176 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
| SMILES | N[C@@H]1CCN2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C13H18N2/c14-11-6-8-15-7-5-10-3-1-2-4-12(10)13(15)9-11/h1-4,11,13H,5-9,14H2/t11-,13+/m1/s1 |
| InChIKey | HNIYDVDUPHDDRF-YPMHNXCESA-N |
| XLogP | 1.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |