C15H23N3O2S — CID 13217504
(2R,11bS)-2-[methyl(methylsulfamoyl)amino]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine (PubChem CID 13217504) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is (2R,11bS)-2-[methyl(methylsulfamoyl)amino]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine.
| Compound Name | (2R,11bS)-2-[methyl(methylsulfamoyl)amino]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 13217504 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2R,11bS)-2-[methyl(methylsulfamoyl)amino]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
| SMILES | CNS(=O)(=O)N(C)[C@@H]1CCN2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-16-21(19,20)17(2)13-8-10-18-9-7-12-5-3-4-6-14(12)15(18)11-13/h3-6,13,15-16H,7-11H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | FGBYTPDYBMLKAJ-HIFRSBDPSA-N |
| XLogP | 1.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |