C13H16ClN — CID 86337762
(2R,11bR)-2-chloro-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine (PubChem CID 86337762) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is (2R,11bR)-2-chloro-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine.
| Compound Name | (2R,11bR)-2-chloro-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 86337762 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (2R,11bR)-2-chloro-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
| SMILES | Cl[C@@H]1CCN2CCc3ccccc3[C@H]2C1 |
| InChI | InChI=1S/C13H16ClN/c14-11-6-8-15-7-5-10-3-1-2-4-12(10)13(15)9-11/h1-4,11,13H,5-9H2/t11-,13-/m1/s1 |
| InChIKey | ZVAFQGZUKSEIBX-DGCLKSJQSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|