C15H23ClN2O2S — CID 45262031
N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethanesulfonamide;hydrochloride (PubChem CID 45262031) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethanesulfonamide;hydrochloride.
| Compound Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 45262031 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)N[C@@H]1CCN2CCc3ccccc3[C@@H]2C1.Cl |
| InChI | InChI=1S/C15H22N2O2S.ClH/c1-2-20(18,19)16-13-8-10-17-9-7-12-5-3-4-6-14(12)15(17)11-13;/h3-6,13,15-16H,2,7-11H2,1H3;1H/t13-,15+;/m1./s1 |
| InChIKey | IWFRGKMGCOEXDT-PBCQUBLHSA-N |
| XLogP | 2.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |