C21H29ClN2O4S — CID 18652829
(1S,16R,21S)-20-(3-chloropropylsulfonyl)-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene (PubChem CID 18652829) has the molecular formula C21H29ClN2O4S and a molecular weight of 440.99 g/mol. Its IUPAC name is (1S,16R,21S)-20-(3-chloropropylsulfonyl)-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene.
| Compound Name | (1S,16R,21S)-20-(3-chloropropylsulfonyl)-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene |
|---|---|
| PubChem CID | 18652829 |
| Molecular Formula | C21H29ClN2O4S |
| Molecular Weight | 440.99 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (1S,16R,21S)-20-(3-chloropropylsulfonyl)-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene |
| SMILES | O=S(=O)(CCCCl)N1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCCO5 |
| InChI | InChI=1S/C21H29ClN2O4S/c22-5-2-10-29(25,26)24-6-1-3-16-14-23-7-4-15-11-20-21(28-9-8-27-20)12-17(15)19(23)13-18(16)24/h11-12,16,18-19H,1-10,13-14H2/t16-,18+,19+/m1/s1 |
| InChIKey | BJIDLTRSWAGGTD-NEWSRXKRSA-N |
| XLogP | 2.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.99 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|