C19H27ClN2O3S — CID 67881539
(8aS,12aR,13aS)-12-(2-chloroethylsulfonyl)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67881539) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is (8aS,12aR,13aS)-12-(2-chloroethylsulfonyl)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aS,12aR,13aS)-12-(2-chloroethylsulfonyl)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67881539 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (8aS,12aR,13aS)-12-(2-chloroethylsulfonyl)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | COc1ccc2c(c1)CCN1C[C@@H]3CCCN(S(=O)(=O)CCCl)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C19H27ClN2O3S/c1-25-16-4-5-17-14(11-16)6-9-21-13-15-3-2-8-22(18(15)12-19(17)21)26(23,24)10-7-20/h4-5,11,15,18-19H,2-3,6-10,12-13H2,1H3/t15-,18+,19-/m0/s1 |
| InChIKey | GIVALLFGLJNAIJ-IPELMVKDSA-N |
| XLogP | 2.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|