C19H29N3O5S2 — CID 67881736
N-[[(8aR,12aS,13aS)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonylmethyl]methanesulfonamide (PubChem CID 67881736) has the molecular formula C19H29N3O5S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[[(8aR,12aS,13aS)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonylmethyl]methanesulfonamide.
| Compound Name | N-[[(8aR,12aS,13aS)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonylmethyl]methanesulfonamide |
|---|---|
| PubChem CID | 67881736 |
| Molecular Formula | C19H29N3O5S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[[(8aR,12aS,13aS)-3-methoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonylmethyl]methanesulfonamide |
| SMILES | COc1ccc2c(c1)CCN1C[C@H]3CCCN(S(=O)(=O)CNS(C)(=O)=O)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C19H29N3O5S2/c1-27-16-5-6-17-14(10-16)7-9-21-12-15-4-3-8-22(18(15)11-19(17)21)29(25,26)13-20-28(2,23)24/h5-6,10,15,18-20H,3-4,7-9,11-13H2,1-2H3/t15-,18+,19+/m1/s1 |
| InChIKey | DCUDCQXMXXGAGT-MNEFBYGVSA-N |
| XLogP | 0.92 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |