C18H27ClN2O2S — CID 67870507
(8aR,12aS,13aR)-1-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride (PubChem CID 67870507) has the molecular formula C18H27ClN2O2S and a molecular weight of 370.95 g/mol. Its IUPAC name is (8aR,12aS,13aR)-1-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride.
| Compound Name | (8aR,12aS,13aR)-1-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 67870507 |
| Molecular Formula | C18H27ClN2O2S |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (8aR,12aS,13aR)-1-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
| SMILES | Cc1cccc2c1[C@H]1C[C@H]3[C@H](CCCN3S(C)(=O)=O)CN1CC2.Cl |
| InChI | InChI=1S/C18H26N2O2S.ClH/c1-13-5-3-6-14-8-10-19-12-15-7-4-9-20(23(2,21)22)16(15)11-17(19)18(13)14;/h3,5-6,15-17H,4,7-12H2,1-2H3;1H/t15-,16+,17-;/m1./s1 |
| InChIKey | DLWPEWXULWMPHD-UNLWNTODSA-N |
| XLogP | 2.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |