C22H26N2O2S — CID 14307720
12-(benzenesulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 14307720) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 12-(benzenesulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | 12-(benzenesulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 14307720 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 12-(benzenesulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | O=S(=O)(c1ccccc1)N1CCCC2CN3CCc4ccccc4C3CC21 |
| InChI | InChI=1S/C22H26N2O2S/c25-27(26,19-9-2-1-3-10-19)24-13-6-8-18-16-23-14-12-17-7-4-5-11-20(17)22(23)15-21(18)24/h1-5,7,9-11,18,21-22H,6,8,12-16H2 |
| InChIKey | DPEYJVOIIDVLEA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |