C23H36N2O3S — CID 21281844
12-(2-methoxyhexylsulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 21281844) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is 12-(2-methoxyhexylsulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | 12-(2-methoxyhexylsulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 21281844 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 12-(2-methoxyhexylsulfonyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCCCC(CS(=O)(=O)N1CCCC2CN3CCc4ccccc4C3CC21)OC |
| InChI | InChI=1S/C23H36N2O3S/c1-3-4-10-20(28-2)17-29(26,27)25-13-7-9-19-16-24-14-12-18-8-5-6-11-21(18)23(24)15-22(19)25/h5-6,8,11,19-20,22-23H,3-4,7,9-10,12-17H2,1-2H3 |
| InChIKey | UXHJAZUXTUALMY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |