C18H27ClN2O3S — CID 67870559
2-[[(8aR,12aS,13aR)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]ethanol;hydrochloride (PubChem CID 67870559) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 2-[[(8aR,12aS,13aR)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]ethanol;hydrochloride.
| Compound Name | 2-[[(8aR,12aS,13aR)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 67870559 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[[(8aR,12aS,13aR)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]ethanol;hydrochloride |
| SMILES | Cl.O=S(=O)(CCO)N1CCC[C@@H]2CN3CCc4ccccc4[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C18H26N2O3S.ClH/c21-10-11-24(22,23)20-8-3-5-15-13-19-9-7-14-4-1-2-6-16(14)18(19)12-17(15)20;/h1-2,4,6,15,17-18,21H,3,5,7-13H2;1H/t15-,17+,18-;/m1./s1 |
| InChIKey | GZJMHLNIBDBDIL-VMJXPXJZSA-N |
| XLogP | 1.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |