C26H33N3O — CID 18636379
(8aS,12aR,13aR)-3-methyl-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide (PubChem CID 18636379) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is (8aS,12aR,13aR)-3-methyl-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide.
| Compound Name | (8aS,12aR,13aR)-3-methyl-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
|---|---|
| PubChem CID | 18636379 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (8aS,12aR,13aR)-3-methyl-N-(2-phenylethyl)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
| SMILES | Cc1ccc2c(c1)CCN1C[C@@H]3CCCN(C(=O)NCCc4ccccc4)[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C26H33N3O/c1-19-9-10-23-21(16-19)12-15-28-18-22-8-5-14-29(24(22)17-25(23)28)26(30)27-13-11-20-6-3-2-4-7-20/h2-4,6-7,9-10,16,22,24-25H,5,8,11-15,17-18H2,1H3,(H,27,30)/t22-,24+,25+/m0/s1 |
| InChIKey | QCTMPOOCDGTNGC-ICDZXHCJSA-N |
| XLogP | 4.33 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |