C26H31N3O3 — CID 18636310
(1S,15R,20S)-N-(2-phenylethyl)-4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8-triene-19-carboxamide (PubChem CID 18636310) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (1S,15R,20S)-N-(2-phenylethyl)-4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8-triene-19-carboxamide.
| Compound Name | (1S,15R,20S)-N-(2-phenylethyl)-4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8-triene-19-carboxamide |
|---|---|
| PubChem CID | 18636310 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (1S,15R,20S)-N-(2-phenylethyl)-4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8-triene-19-carboxamide |
| SMILES | O=C(NCCc1ccccc1)N1CCC[C@@H]2CN3CCc4ccc5c(c4[C@@H]3C[C@@H]21)OCO5 |
| InChI | InChI=1S/C26H31N3O3/c30-26(27-12-10-18-5-2-1-3-6-18)29-13-4-7-20-16-28-14-11-19-8-9-23-25(32-17-31-23)24(19)22(28)15-21(20)29/h1-3,5-6,8-9,20-22H,4,7,10-17H2,(H,27,30)/t20-,21+,22+/m1/s1 |
| InChIKey | SVQFMFZDULMQMN-FSSWDIPSSA-N |
| XLogP | 3.75 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |