C24H29N3O2 — CID 15086883
(8aR,12aS,13aS)-3-methoxy-N-phenyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide (PubChem CID 15086883) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (8aR,12aS,13aS)-3-methoxy-N-phenyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide.
| Compound Name | (8aR,12aS,13aS)-3-methoxy-N-phenyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
|---|---|
| PubChem CID | 15086883 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (8aR,12aS,13aS)-3-methoxy-N-phenyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
| SMILES | COc1ccc2c(c1)CCN1C[C@H]3CCCN(C(=O)Nc4ccccc4)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C24H29N3O2/c1-29-20-9-10-21-17(14-20)11-13-26-16-18-6-5-12-27(22(18)15-23(21)26)24(28)25-19-7-3-2-4-8-19/h2-4,7-10,14,18,22-23H,5-6,11-13,15-16H2,1H3,(H,25,28)/t18-,22+,23+/m1/s1 |
| InChIKey | VXYIPOYNLYPXQA-LEOXJPRUSA-N |
| XLogP | 4.31 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |