C16H23NO — CID 54496451
(4aS,10aS)-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol (PubChem CID 54496451) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (4aS,10aS)-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol.
| Compound Name | (4aS,10aS)-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol |
|---|---|
| PubChem CID | 54496451 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (4aS,10aS)-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol |
| SMILES | CN1CCC[C@@H]2[C@@H]1Cc1ccc(O)cc1C2(C)C |
| InChI | InChI=1S/C16H23NO/c1-16(2)13-5-4-8-17(3)15(13)9-11-6-7-12(18)10-14(11)16/h6-7,10,13,15,18H,4-5,8-9H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | XZLGSTGEGFDDAB-HIFRSBDPSA-N |
| XLogP | 2.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |