C17H23NO2 — CID 162462697
(1R,9S,10S,13S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol (PubChem CID 162462697) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (1R,9S,10S,13S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol.
| Compound Name | (1R,9S,10S,13S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol |
|---|---|
| PubChem CID | 162462697 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (1R,9S,10S,13S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,13-diol |
| SMILES | CN1CC[C@@]23C[C@@H](O)CC[C@@H]2[C@@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H23NO2/c1-18-7-6-17-10-13(20)4-5-14(17)16(18)8-11-2-3-12(19)9-15(11)17/h2-3,9,13-14,16,19-20H,4-8,10H2,1H3/t13-,14+,16-,17+/m0/s1 |
| InChIKey | COGHVMPBMULGFB-HDEZJCGLSA-N |
| XLogP | 2.05 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |