C16H21NO2 — CID 90679801
(1S,9R,10R)-17-methyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 90679801) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (1S,9R,10R)-17-methyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,10R)-17-methyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 90679801 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (1S,9R,10R)-17-methyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@]23CCCO[C@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C16H21NO2/c1-17-7-6-16-5-2-8-19-15(16)14(17)9-11-3-4-12(18)10-13(11)16/h3-4,10,14-15,18H,2,5-9H2,1H3/t14-,15+,16+/m1/s1 |
| InChIKey | RFNWFZMJOKXVOP-PMPSAXMXSA-N |
| XLogP | 2.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |