C19H27NO — CID 54447570
(4aS,10aR)-5,5-dimethyl-1-(2-methylprop-2-enyl)-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol (PubChem CID 54447570) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (4aS,10aR)-5,5-dimethyl-1-(2-methylprop-2-enyl)-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol.
| Compound Name | (4aS,10aR)-5,5-dimethyl-1-(2-methylprop-2-enyl)-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol |
|---|---|
| PubChem CID | 54447570 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (4aS,10aR)-5,5-dimethyl-1-(2-methylprop-2-enyl)-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-7-ol |
| SMILES | C=C(C)CN1CCC[C@@H]2[C@H]1Cc1ccc(O)cc1C2(C)C |
| InChI | InChI=1S/C19H27NO/c1-13(2)12-20-9-5-6-16-18(20)10-14-7-8-15(21)11-17(14)19(16,3)4/h7-8,11,16,18,21H,1,5-6,9-10,12H2,2-4H3/t16-,18-/m1/s1 |
| InChIKey | WSPUDRKHAGEJDC-SJLPKXTDSA-N |
| XLogP | 3.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|