C22H28O5 — CID 70125414
2-[(8R,9R,11R,13R,14R,17S)-9,11-dihydroxy-3-methoxy-13-methyl-15-methylidene-6,7,8,11,12,14,16,17-octahydrocyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 70125414) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is 2-[(8R,9R,11R,13R,14R,17S)-9,11-dihydroxy-3-methoxy-13-methyl-15-methylidene-6,7,8,11,12,14,16,17-octahydrocyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(8R,9R,11R,13R,14R,17S)-9,11-dihydroxy-3-methoxy-13-methyl-15-methylidene-6,7,8,11,12,14,16,17-octahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 70125414 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-[(8R,9R,11R,13R,14R,17S)-9,11-dihydroxy-3-methoxy-13-methyl-15-methylidene-6,7,8,11,12,14,16,17-octahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | C=C1C[C@@H](CC(=O)O)[C@@]2(C)C[C@@H](O)[C@]3(O)c4ccc(OC)cc4CC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C22H28O5/c1-12-8-14(10-19(24)25)21(2)11-18(23)22(26)16-7-5-15(27-3)9-13(16)4-6-17(22)20(12)21/h5,7,9,14,17-18,20,23,26H,1,4,6,8,10-11H2,2-3H3,(H,24,25)/t14-,17+,18+,20-,21+,22-/m0/s1 |
| InChIKey | HXFVRMYJSRQZJV-BUNANQRPSA-N |
| XLogP | 2.88 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|