C22H30O4 — CID 67919234
[(8S,9R,11S,13R,14S,17S)-17-ethyl-9,11-dihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67919234) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(8S,9R,11S,13R,14S,17S)-17-ethyl-9,11-dihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9R,11S,13R,14S,17S)-17-ethyl-9,11-dihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67919234 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(8S,9R,11S,13R,14S,17S)-17-ethyl-9,11-dihydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCc4cc(OC(C)=O)ccc4[C@@]3(O)[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C22H30O4/c1-4-15-6-9-18-19-8-5-14-11-16(26-13(2)23)7-10-17(14)22(19,25)20(24)12-21(15,18)3/h7,10-11,15,18-20,24-25H,4-6,8-9,12H2,1-3H3/t15-,18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | HWXAWOCKBXGLIZ-USUWBSJTSA-N |
| XLogP | 3.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|