C18H22O4 — CID 70389447
(2S,4aS,10aS)-7-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid (PubChem CID 70389447) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S,4aS,10aS)-7-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid.
| Compound Name | (2S,4aS,10aS)-7-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 70389447 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S,4aS,10aS)-7-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid |
| SMILES | CC(=O)Oc1ccc2c(c1)CC[C@H]1C[C@@](C)(C(=O)O)CC[C@H]21 |
| InChI | InChI=1S/C18H22O4/c1-11(19)22-14-5-6-15-12(9-14)3-4-13-10-18(2,17(20)21)8-7-16(13)15/h5-6,9,13,16H,3-4,7-8,10H2,1-2H3,(H,20,21)/t13-,16-,18-/m0/s1 |
| InChIKey | ULBVUDXHWXWEFN-OWQGQXMQSA-N |
| XLogP | 3.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|