C27H31FO2 — CID 174178372
[(8S,9S,13S,14S,17S)-17-(4-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 174178372) has the molecular formula C27H31FO2 and a molecular weight of 406.54 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17S)-17-(4-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,13S,14S,17S)-17-(4-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 174178372 |
| Molecular Formula | C27H31FO2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [(8S,9S,13S,14S,17S)-17-(4-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H31FO2/c1-17(29)30-21-9-11-22-18(16-21)4-10-24-23(22)12-14-27(3)25(24)13-15-26(27,2)19-5-7-20(28)8-6-19/h5-9,11,16,23-25H,4,10,12-15H2,1-3H3/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | BNNSXKDNHVYMFT-SEFGFODJSA-N |
| XLogP | 6.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|