C28H31FO3 — CID 11384993
[(8R,9S,13S,14S,17R)-17-[(Z)-2-(4-fluorophenyl)ethenyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11384993) has the molecular formula C28H31FO3 and a molecular weight of 434.55 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-17-[(Z)-2-(4-fluorophenyl)ethenyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17R)-17-[(Z)-2-(4-fluorophenyl)ethenyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11384993 |
| Molecular Formula | C28H31FO3 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-17-[(Z)-2-(4-fluorophenyl)ethenyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)/C=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C28H31FO3/c1-18(30)32-22-8-10-23-20(17-22)5-9-25-24(23)12-14-27(2)26(25)13-16-28(27,31)15-11-19-3-6-21(29)7-4-19/h3-4,6-8,10-11,15,17,24-26,31H,5,9,12-14,16H2,1-2H3/b15-11-/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | WZWAMZJZXGNGCE-NJHOLIOHSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|