C25H29FO — CID 174178293
(8S,9S,13S,14S,17S)-17-(3-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 174178293) has the molecular formula C25H29FO and a molecular weight of 364.50 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-17-(3-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13S,14S,17S)-17-(3-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 174178293 |
| Molecular Formula | C25H29FO |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (8S,9S,13S,14S,17S)-17-(3-fluorophenyl)-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@]2(C)c1cccc(F)c1 |
| InChI | InChI=1S/C25H29FO/c1-24(17-4-3-5-18(26)15-17)13-11-23-22-8-6-16-14-19(27)7-9-20(16)21(22)10-12-25(23,24)2/h3-5,7,9,14-15,21-23,27H,6,8,10-13H2,1-2H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | QHWVJGMLTNTNFD-RXFVIIJJSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |