C37H44O7 — CID 137451287
[(10aS)-6-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carbonyl] (4aS)-7-acetyloxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 137451287) has the molecular formula C37H44O7 and a molecular weight of 600.75 g/mol. Its IUPAC name is [(10aS)-6-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carbonyl] (4aS)-7-acetyloxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | [(10aS)-6-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carbonyl] (4aS)-7-acetyloxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 137451287 |
| Molecular Formula | C37H44O7 |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | [(10aS)-6-acetyloxy-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carbonyl] (4aS)-7-acetyloxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC1C(C)(C(=O)OC(=O)C3(C)CCC4c5cc(OC(C)=O)ccc5CC[C@H]4C3)CCC[C@]21C |
| InChI | InChI=1S/C37H44O7/c1-22(38)42-27-12-13-31-25(19-27)10-14-32-36(31,4)16-6-17-37(32,5)34(41)44-33(40)35(3)18-15-29-26(21-35)8-7-24-9-11-28(20-30(24)29)43-23(2)39/h9,11-13,19-20,26,29,32H,6-8,10,14-18,21H2,1-5H3/t26-,29?,32?,35?,36+,37?/m0/s1 |
| InChIKey | POVAHHFCLWZISW-LHWFCQEPSA-N |
| XLogP | 7.15 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|