C22H25NO7 — CID 10024857
[(8S,9R,13S,14S,17R)-17-ethynyl-9,17-dihydroxy-13-methyl-11-nitrooxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10024857) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is [(8S,9R,13S,14S,17R)-17-ethynyl-9,17-dihydroxy-13-methyl-11-nitrooxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9R,13S,14S,17R)-17-ethynyl-9,17-dihydroxy-13-methyl-11-nitrooxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10024857 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(8S,9R,13S,14S,17R)-17-ethynyl-9,17-dihydroxy-13-methyl-11-nitrooxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OC(C)=O)ccc4[C@@]3(O)C(O[N+](=O)[O-])C[C@@]21C |
| InChI | InChI=1S/C22H25NO7/c1-4-21(25)10-9-17-18-7-5-14-11-15(29-13(2)24)6-8-16(14)22(18,26)19(30-23(27)28)12-20(17,21)3/h1,6,8,11,17-19,25-26H,5,7,9-10,12H2,2-3H3/t17-,18-,19?,20-,21-,22-/m0/s1 |
| InChIKey | HQNQCSQGQINENM-IMSBAZIWSA-N |
| XLogP | 2.12 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|