C25H32O6S — CID 22796229
[(7R,8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7-propan-2-ylsulfonyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 22796229) has the molecular formula C25H32O6S and a molecular weight of 460.59 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7-propan-2-ylsulfonyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(7R,8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7-propan-2-ylsulfonyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 22796229 |
| Molecular Formula | C25H32O6S |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [(7R,8R,9S,13S,14S,17R)-17-ethynyl-17-hydroxy-13-methyl-7-propan-2-ylsulfonyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@H]3[C@H](CC[C@@]21C)c1ccc(OC(C)=O)cc1C[C@H]3OS(=O)(=O)C(C)C |
| InChI | InChI=1S/C25H32O6S/c1-6-25(27)12-10-21-23-20(9-11-24(21,25)5)19-8-7-18(30-16(4)26)13-17(19)14-22(23)31-32(28,29)15(2)3/h1,7-8,13,15,20-23,27H,9-12,14H2,2-5H3/t20-,21+,22-,23-,24+,25+/m1/s1 |
| InChIKey | YDYZDNQNLMRKJJ-KCAOPCNBSA-N |
| XLogP | 3.57 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|