C29H36O5 — CID 22796241
[(7S,8R,9S,13S,14S,17R)-17-acetyloxy-3-cyclopentyloxy-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 22796241) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(7S,8R,9S,13S,14S,17R)-17-acetyloxy-3-cyclopentyloxy-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(7S,8R,9S,13S,14S,17R)-17-acetyloxy-3-cyclopentyloxy-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 22796241 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [(7S,8R,9S,13S,14S,17R)-17-acetyloxy-3-cyclopentyloxy-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)CC[C@H]2[C@@H]3[C@@H](OC(C)=O)Cc4cc(OC5CCCC5)ccc4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H36O5/c1-5-29(34-19(3)31)15-13-25-27-24(12-14-28(25,29)4)23-11-10-22(33-21-8-6-7-9-21)16-20(23)17-26(27)32-18(2)30/h1,10-11,16,21,24-27H,6-9,12-15,17H2,2-4H3/t24-,25+,26+,27-,28+,29+/m1/s1 |
| InChIKey | MGKKXNJVWVOWDU-RTSBVXMDSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|